C9H8F3N5O2 — CID 168658526
4-(azidomethyl)-1-[4-(trifluoromethyl)-1,3-oxazol-2-yl]pyrrolidin-2-one (PubChem CID 168658526) has the molecular formula C9H8F3N5O2 and a molecular weight of 275.19 g/mol. Its IUPAC name is 4-(azidomethyl)-1-[4-(trifluoromethyl)-1,3-oxazol-2-yl]pyrrolidin-2-one.
| Compound Name | 4-(azidomethyl)-1-[4-(trifluoromethyl)-1,3-oxazol-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168658526 |
| Molecular Formula | C9H8F3N5O2 |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 4-(azidomethyl)-1-[4-(trifluoromethyl)-1,3-oxazol-2-yl]pyrrolidin-2-one |
| SMILES | [N-]=[N+]=NCC1CC(=O)N(c2nc(C(F)(F)F)co2)C1 |
| InChI | InChI=1S/C9H8F3N5O2/c10-9(11,12)6-4-19-8(15-6)17-3-5(1-7(17)18)2-14-16-13/h4-5H,1-3H2 |
| InChIKey | YJNOHUPCAGILTO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 95.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|