C12H10BrN5O2 — CID 168658564
4-(azidomethyl)-1-(5-bromo-1,3-benzoxazol-2-yl)pyrrolidin-2-one (PubChem CID 168658564) has the molecular formula C12H10BrN5O2 and a molecular weight of 336.15 g/mol. Its IUPAC name is 4-(azidomethyl)-1-(5-bromo-1,3-benzoxazol-2-yl)pyrrolidin-2-one.
| Compound Name | 4-(azidomethyl)-1-(5-bromo-1,3-benzoxazol-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168658564 |
| Molecular Formula | C12H10BrN5O2 |
| Molecular Weight | 336.15 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 4-(azidomethyl)-1-(5-bromo-1,3-benzoxazol-2-yl)pyrrolidin-2-one |
| SMILES | [N-]=[N+]=NCC1CC(=O)N(c2nc3cc(Br)ccc3o2)C1 |
| InChI | InChI=1S/C12H10BrN5O2/c13-8-1-2-10-9(4-8)16-12(20-10)18-6-7(3-11(18)19)5-15-17-14/h1-2,4,7H,3,5-6H2 |
| InChIKey | FFNFTFLWAIGWAZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 95.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.15 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|