C13H11BrN2O2 — CID 168686637
1-(5-bromo-1,3-benzoxazol-2-yl)-4-ethenylpyrrolidin-2-one (PubChem CID 168686637) has the molecular formula C13H11BrN2O2 and a molecular weight of 307.15 g/mol. Its IUPAC name is 1-(5-bromo-1,3-benzoxazol-2-yl)-4-ethenylpyrrolidin-2-one.
| Compound Name | 1-(5-bromo-1,3-benzoxazol-2-yl)-4-ethenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168686637 |
| Molecular Formula | C13H11BrN2O2 |
| Molecular Weight | 307.15 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 1-(5-bromo-1,3-benzoxazol-2-yl)-4-ethenylpyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2nc3cc(Br)ccc3o2)C1 |
| InChI | InChI=1S/C13H11BrN2O2/c1-2-8-5-12(17)16(7-8)13-15-10-6-9(14)3-4-11(10)18-13/h2-4,6,8H,1,5,7H2 |
| InChIKey | XCSCFTPQYCVBDQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.15 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|