C11H9Cl2FN4O — CID 168658269
4-(azidomethyl)-1-(3,5-dichloro-2-fluorophenyl)pyrrolidin-2-one (PubChem CID 168658269) has the molecular formula C11H9Cl2FN4O and a molecular weight of 303.12 g/mol. Its IUPAC name is 4-(azidomethyl)-1-(3,5-dichloro-2-fluorophenyl)pyrrolidin-2-one.
| Compound Name | 4-(azidomethyl)-1-(3,5-dichloro-2-fluorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168658269 |
| Molecular Formula | C11H9Cl2FN4O |
| Molecular Weight | 303.12 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 4-(azidomethyl)-1-(3,5-dichloro-2-fluorophenyl)pyrrolidin-2-one |
| SMILES | [N-]=[N+]=NCC1CC(=O)N(c2cc(Cl)cc(Cl)c2F)C1 |
| InChI | InChI=1S/C11H9Cl2FN4O/c12-7-2-8(13)11(14)9(3-7)18-5-6(1-10(18)19)4-16-17-15/h2-3,6H,1,4-5H2 |
| InChIKey | DJLUQDFGMKDIKZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 69.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.12 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|