C11H11F2N5O — CID 168657581
1-(6-amino-2,3-difluorophenyl)-4-(azidomethyl)pyrrolidin-2-one (PubChem CID 168657581) has the molecular formula C11H11F2N5O and a molecular weight of 267.24 g/mol. Its IUPAC name is 1-(6-amino-2,3-difluorophenyl)-4-(azidomethyl)pyrrolidin-2-one.
| Compound Name | 1-(6-amino-2,3-difluorophenyl)-4-(azidomethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168657581 |
| Molecular Formula | C11H11F2N5O |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 1-(6-amino-2,3-difluorophenyl)-4-(azidomethyl)pyrrolidin-2-one |
| SMILES | [N-]=[N+]=NCC1CC(=O)N(c2c(N)ccc(F)c2F)C1 |
| InChI | InChI=1S/C11H11F2N5O/c12-7-1-2-8(14)11(10(7)13)18-5-6(3-9(18)19)4-16-17-15/h1-2,6H,3-5,14H2 |
| InChIKey | LQUVZRZANWEMDM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 95.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|