C11H12F2N2O2 — CID 168663375
1-(6-amino-2,3-difluorophenyl)-4-(hydroxymethyl)pyrrolidin-2-one (PubChem CID 168663375) has the molecular formula C11H12F2N2O2 and a molecular weight of 242.22 g/mol. Its IUPAC name is 1-(6-amino-2,3-difluorophenyl)-4-(hydroxymethyl)pyrrolidin-2-one.
| Compound Name | 1-(6-amino-2,3-difluorophenyl)-4-(hydroxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168663375 |
| Molecular Formula | C11H12F2N2O2 |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 1-(6-amino-2,3-difluorophenyl)-4-(hydroxymethyl)pyrrolidin-2-one |
| SMILES | Nc1ccc(F)c(F)c1N1CC(CO)CC1=O |
| InChI | InChI=1S/C11H12F2N2O2/c12-7-1-2-8(14)11(10(7)13)15-4-6(5-16)3-9(15)17/h1-2,6,16H,3-5,14H2 |
| InChIKey | CLQYCYKTOQRROW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|