C11H10F2N2O3S — CID 168671370
1-(2,3-difluoro-6-nitrophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168671370) has the molecular formula C11H10F2N2O3S and a molecular weight of 288.27 g/mol. Its IUPAC name is 1-(2,3-difluoro-6-nitrophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-(2,3-difluoro-6-nitrophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168671370 |
| Molecular Formula | C11H10F2N2O3S |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 1-(2,3-difluoro-6-nitrophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CS)CN1c1c([N+](=O)[O-])ccc(F)c1F |
| InChI | InChI=1S/C11H10F2N2O3S/c12-7-1-2-8(15(17)18)11(10(7)13)14-4-6(5-19)3-9(14)16/h1-2,6,19H,3-5H2 |
| InChIKey | VEKOSMFGFBSICJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 63.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|