C11H9BrF2N4O — CID 168657559
4-(azidomethyl)-1-(2-bromo-4,6-difluorophenyl)pyrrolidin-2-one (PubChem CID 168657559) has the molecular formula C11H9BrF2N4O and a molecular weight of 331.12 g/mol. Its IUPAC name is 4-(azidomethyl)-1-(2-bromo-4,6-difluorophenyl)pyrrolidin-2-one.
| Compound Name | 4-(azidomethyl)-1-(2-bromo-4,6-difluorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168657559 |
| Molecular Formula | C11H9BrF2N4O |
| Molecular Weight | 331.12 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 4-(azidomethyl)-1-(2-bromo-4,6-difluorophenyl)pyrrolidin-2-one |
| SMILES | [N-]=[N+]=NCC1CC(=O)N(c2c(F)cc(F)cc2Br)C1 |
| InChI | InChI=1S/C11H9BrF2N4O/c12-8-2-7(13)3-9(14)11(8)18-5-6(1-10(18)19)4-16-17-15/h2-3,6H,1,4-5H2 |
| InChIKey | ZYDSIFKKBKVUHO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 69.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.12 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|