C9H9ClN6O2 — CID 168658554
2-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-4-chloro-1H-pyrimidin-6-one (PubChem CID 168658554) has the molecular formula C9H9ClN6O2 and a molecular weight of 268.66 g/mol. Its IUPAC name is 2-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-4-chloro-1H-pyrimidin-6-one.
| Compound Name | 2-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-4-chloro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 168658554 |
| Molecular Formula | C9H9ClN6O2 |
| Molecular Weight | 268.66 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-4-chloro-1H-pyrimidin-6-one |
| SMILES | [N-]=[N+]=NCC1CC(=O)N(c2nc(Cl)cc(=O)[nH]2)C1 |
| InChI | InChI=1S/C9H9ClN6O2/c10-6-2-7(17)14-9(13-6)16-4-5(1-8(16)18)3-12-15-11/h2,5H,1,3-4H2,(H,13,14,17) |
| InChIKey | CUHLAVILKNGZBV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.66 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|