C11H15N3O2 — CID 168659830
3-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-5-methyl-1H-pyridin-2-one (PubChem CID 168659830) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 3-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-5-methyl-1H-pyridin-2-one.
| Compound Name | 3-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-5-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 168659830 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 3-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-5-methyl-1H-pyridin-2-one |
| SMILES | Cc1c[nH]c(=O)c(N2CC(CN)CC2=O)c1 |
| InChI | InChI=1S/C11H15N3O2/c1-7-2-9(11(16)13-5-7)14-6-8(4-12)3-10(14)15/h2,5,8H,3-4,6,12H2,1H3,(H,13,16) |
| InChIKey | RSJWJVRXBDUWJH-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |