C10H11ClN2O2 — CID 168664302
1-(4-chloro-2-pyridinyl)-4-(hydroxymethyl)pyrrolidin-2-one (PubChem CID 168664302) has the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. Its IUPAC name is 1-(4-chloro-2-pyridinyl)-4-(hydroxymethyl)pyrrolidin-2-one.
| Compound Name | 1-(4-chloro-2-pyridinyl)-4-(hydroxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168664302 |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 1-(4-chloro-2-pyridinyl)-4-(hydroxymethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CO)CN1c1cc(Cl)ccn1 |
| InChI | InChI=1S/C10H11ClN2O2/c11-8-1-2-12-9(4-8)13-5-7(6-14)3-10(13)15/h1-2,4,7,14H,3,5-6H2 |
| InChIKey | BFSAFSVZMNTJIP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |