C11H11N3O2 — CID 168663615
6-[4-(hydroxymethyl)-2-oxopyrrolidin-1-yl]pyridine-3-carbonitrile (PubChem CID 168663615) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 6-[4-(hydroxymethyl)-2-oxopyrrolidin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-(hydroxymethyl)-2-oxopyrrolidin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168663615 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 6-[4-(hydroxymethyl)-2-oxopyrrolidin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CC(CO)CC2=O)nc1 |
| InChI | InChI=1S/C11H11N3O2/c12-4-8-1-2-10(13-5-8)14-6-9(7-15)3-11(14)16/h1-2,5,9,15H,3,6-7H2 |
| InChIKey | JUINKTJACXWFGT-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |