C10H7N3O2 — CID 71813200
6-(2,5-dioxopyrrolidin-1-yl)pyridine-3-carbonitrile (PubChem CID 71813200) has the molecular formula C10H7N3O2 and a molecular weight of 201.19 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrolidin-1-yl)pyridine-3-carbonitrile.
| Compound Name | 6-(2,5-dioxopyrrolidin-1-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 71813200 |
| Molecular Formula | C10H7N3O2 |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 6-(2,5-dioxopyrrolidin-1-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2C(=O)CCC2=O)nc1 |
| InChI | InChI=1S/C10H7N3O2/c11-5-7-1-2-8(12-6-7)13-9(14)3-4-10(13)15/h1-2,6H,3-4H2 |
| InChIKey | ISYMMYLBJDMHHL-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|