C9H5N5O2 — CID 175302065
1-(5-cyano-2-pyridinyl)-1,2,4-triazole-3-carboxylic acid (PubChem CID 175302065) has the molecular formula C9H5N5O2 and a molecular weight of 215.17 g/mol. Its IUPAC name is 1-(5-cyano-2-pyridinyl)-1,2,4-triazole-3-carboxylic acid.
| Compound Name | 1-(5-cyano-2-pyridinyl)-1,2,4-triazole-3-carboxylic acid |
|---|---|
| PubChem CID | 175302065 |
| Molecular Formula | C9H5N5O2 |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 1-(5-cyano-2-pyridinyl)-1,2,4-triazole-3-carboxylic acid |
| SMILES | N#Cc1ccc(-n2cnc(C(=O)O)n2)nc1 |
| InChI | InChI=1S/C9H5N5O2/c10-3-6-1-2-7(11-4-6)14-5-12-8(13-14)9(15)16/h1-2,4-5H,(H,15,16) |
| InChIKey | KBXHKOPTYQNMGZ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |