C9H9N5O — CID 141138657
1-(5-methyl-2-pyridinyl)-1,2,4-triazole-3-carboxamide (PubChem CID 141138657) has the molecular formula C9H9N5O and a molecular weight of 203.21 g/mol. Its IUPAC name is 1-(5-methyl-2-pyridinyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-(5-methyl-2-pyridinyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 141138657 |
| Molecular Formula | C9H9N5O |
| Molecular Weight | 203.21 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 1-(5-methyl-2-pyridinyl)-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1ccc(-n2cnc(C(N)=O)n2)nc1 |
| InChI | InChI=1S/C9H9N5O/c1-6-2-3-7(11-4-6)14-5-12-9(13-14)8(10)15/h2-5H,1H3,(H2,10,15) |
| InChIKey | RUZOZRWUJFSWQE-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.21 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |