C11H12BrF2NO — CID 168665362
4-(4-bromo-2,5-difluorophenoxy)piperidine (PubChem CID 168665362) has the molecular formula C11H12BrF2NO and a molecular weight of 292.12 g/mol. Its IUPAC name is 4-(4-bromo-2,5-difluorophenoxy)piperidine.
| Compound Name | 4-(4-bromo-2,5-difluorophenoxy)piperidine |
|---|---|
| PubChem CID | 168665362 |
| Molecular Formula | C11H12BrF2NO |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 4-(4-bromo-2,5-difluorophenoxy)piperidine |
| SMILES | Fc1cc(OC2CCNCC2)c(F)cc1Br |
| InChI | InChI=1S/C11H12BrF2NO/c12-8-5-10(14)11(6-9(8)13)16-7-1-3-15-4-2-7/h5-7,15H,1-4H2 |
| InChIKey | AWOFWJTVWODMLD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|