C13H17Br2NO2 — CID 79404103
4-(2,5-dibromo-4-methoxyphenoxy)azepane (PubChem CID 79404103) has the molecular formula C13H17Br2NO2 and a molecular weight of 379.09 g/mol. Its IUPAC name is 4-(2,5-dibromo-4-methoxyphenoxy)azepane.
| Compound Name | 4-(2,5-dibromo-4-methoxyphenoxy)azepane |
|---|---|
| PubChem CID | 79404103 |
| Molecular Formula | C13H17Br2NO2 |
| Molecular Weight | 379.09 g/mol |
| Exact Mass | 376.96 |
| IUPAC Name | 4-(2,5-dibromo-4-methoxyphenoxy)azepane |
| SMILES | COc1cc(Br)c(OC2CCCNCC2)cc1Br |
| InChI | InChI=1S/C13H17Br2NO2/c1-17-12-7-11(15)13(8-10(12)14)18-9-3-2-5-16-6-4-9/h7-9,16H,2-6H2,1H3 |
| InChIKey | FMWZODLVOYCIRH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.09 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |