C13H17N3O4S — CID 168666186
S-[[5-oxo-1-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]pyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168666186) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is S-[[5-oxo-1-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]pyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[5-oxo-1-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]pyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168666186 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | S-[[5-oxo-1-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]pyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CC(=O)N(c2nnc(C3CCCO3)o2)C1 |
| InChI | InChI=1S/C13H17N3O4S/c1-8(17)21-7-9-5-11(18)16(6-9)13-15-14-12(20-13)10-3-2-4-19-10/h9-10H,2-7H2,1H3 |
| InChIKey | ILOMJNGCGWNDJB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|