C13H16N2O3S2 — CID 168666408
S-[[1-(4-acetyl-3-methyl-1,2-thiazol-5-yl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168666408) has the molecular formula C13H16N2O3S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is S-[[1-(4-acetyl-3-methyl-1,2-thiazol-5-yl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[1-(4-acetyl-3-methyl-1,2-thiazol-5-yl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168666408 |
| Molecular Formula | C13H16N2O3S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | S-[[1-(4-acetyl-3-methyl-1,2-thiazol-5-yl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CC(=O)N(c2snc(C)c2C(C)=O)C1 |
| InChI | InChI=1S/C13H16N2O3S2/c1-7-12(8(2)16)13(20-14-7)15-5-10(4-11(15)18)6-19-9(3)17/h10H,4-6H2,1-3H3 |
| InChIKey | SCXSBEFAJINCDH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|