About 1-(5-propyl-1,3,4-oxadiazol-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one
1-(5-propyl-1,3,4-oxadiazol-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168669787) has the molecular formula C10H15N3O2S
and a molecular weight of 241.32 g/mol. Its IUPAC name is 1-(5-propyl-1,3,4-oxadiazol-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-(5-propyl-1,3,4-oxadiazol-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| PubChem CID | 168669787 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 1-(5-propyl-1,3,4-oxadiazol-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | CCCc1nnc(N2CC(CS)CC2=O)o1 |
| InChI | InChI=1S/C10H15N3O2S/c1-2-3-8-11-12-10(15-8)13-5-7(6-16)4-9(13)14/h7,16H,2-6H2,1H3 |
| InChIKey | OPGIHRGEDLVNFC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 59.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-propyl-1,3,4-oxadiazol-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-propyl-1,3,4-oxadiazol-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one?
The IUPAC name of 1-(5-propyl-1,3,4-oxadiazol-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one (CID 168669787) is 1-(5-propyl-1,3,4-oxadiazol-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one.
What is the SMILES notation for 1-(5-propyl-1,3,4-oxadiazol-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one?
The canonical SMILES for 1-(5-propyl-1,3,4-oxadiazol-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one is CCCc1nnc(N2CC(CS)CC2=O)o1.
What is the InChIKey of 1-(5-propyl-1,3,4-oxadiazol-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one?
The InChIKey is OPGIHRGEDLVNFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2S/c1-2-3-8-11-12-10(15-8)13-5-7(6-16)4-9(13)14/h7,16H,2-6H2,1H3.
What are the key properties of 1-(5-propyl-1,3,4-oxadiazol-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one?
1-(5-propyl-1,3,4-oxadiazol-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one has a molecular weight of 241.32 g/mol, XLogP of 1.30, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-propyl-1,3,4-oxadiazol-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one is sourced from PubChem (CID 168669787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).