C11H17N3OS — CID 168669786
1-(5-propyl-1H-pyrazol-3-yl)-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168669786) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is 1-(5-propyl-1H-pyrazol-3-yl)-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-(5-propyl-1H-pyrazol-3-yl)-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168669786 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 1-(5-propyl-1H-pyrazol-3-yl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | CCCc1cc(N2CC(CS)CC2=O)n[nH]1 |
| InChI | InChI=1S/C11H17N3OS/c1-2-3-9-5-10(13-12-9)14-6-8(7-16)4-11(14)15/h5,8,16H,2-4,6-7H2,1H3,(H,12,13) |
| InChIKey | OCTMCXPYYHSFSG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|