C22H24N2O4 — CID 16866990
4-butoxy-N-[[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]methyl]benzamide (PubChem CID 16866990) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 4-butoxy-N-[[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]methyl]benzamide.
| Compound Name | 4-butoxy-N-[[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 16866990 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 4-butoxy-N-[[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]methyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCc2cc(-c3cccc(OC)c3)on2)cc1 |
| InChI | InChI=1S/C22H24N2O4/c1-3-4-12-27-19-10-8-16(9-11-19)22(25)23-15-18-14-21(28-24-18)17-6-5-7-20(13-17)26-2/h5-11,13-14H,3-4,12,15H2,1-2H3,(H,23,25) |
| InChIKey | BDJQORMPJXMFNR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|