C13H13NO3S — CID 168672013
1-(3-oxo-1H-2-benzofuran-5-yl)-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168672013) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is 1-(3-oxo-1H-2-benzofuran-5-yl)-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-(3-oxo-1H-2-benzofuran-5-yl)-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168672013 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 1-(3-oxo-1H-2-benzofuran-5-yl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | O=C1OCc2ccc(N3CC(CS)CC3=O)cc21 |
| InChI | InChI=1S/C13H13NO3S/c15-12-3-8(7-18)5-14(12)10-2-1-9-6-17-13(16)11(9)4-10/h1-2,4,8,18H,3,5-7H2 |
| InChIKey | UPRRCBKSUORFFD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|