C11H10ClF3N2O3S — CID 168674565
[5-oxo-1-[4-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168674565) has the molecular formula C11H10ClF3N2O3S and a molecular weight of 342.73 g/mol. Its IUPAC name is [5-oxo-1-[4-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [5-oxo-1-[4-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168674565 |
| Molecular Formula | C11H10ClF3N2O3S |
| Molecular Weight | 342.73 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | [5-oxo-1-[4-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | O=C1CC(CS(=O)(=O)Cl)CN1c1cc(C(F)(F)F)ccn1 |
| InChI | InChI=1S/C11H10ClF3N2O3S/c12-21(19,20)6-7-3-10(18)17(5-7)9-4-8(1-2-16-9)11(13,14)15/h1-2,4,7H,3,5-6H2 |
| InChIKey | KRDPZQHOXQKJAJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.73 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |