C12H20FNO3S — CID 168674625
[1-(2-methylcyclohexyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168674625) has the molecular formula C12H20FNO3S and a molecular weight of 277.36 g/mol. Its IUPAC name is [1-(2-methylcyclohexyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(2-methylcyclohexyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168674625 |
| Molecular Formula | C12H20FNO3S |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | [1-(2-methylcyclohexyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | CC1CCCCC1N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C12H20FNO3S/c1-9-4-2-3-5-11(9)14-7-10(6-12(14)15)8-18(13,16)17/h9-11H,2-8H2,1H3 |
| InChIKey | LOTZTEOZIDCSKJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |