C11H21FN2O3S — CID 168675163
[1-[2-[methyl(propan-2-yl)amino]ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168675163) has the molecular formula C11H21FN2O3S and a molecular weight of 280.36 g/mol. Its IUPAC name is [1-[2-[methyl(propan-2-yl)amino]ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-[2-[methyl(propan-2-yl)amino]ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168675163 |
| Molecular Formula | C11H21FN2O3S |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | [1-[2-[methyl(propan-2-yl)amino]ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | CC(C)N(C)CCN1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C11H21FN2O3S/c1-9(2)13(3)4-5-14-7-10(6-11(14)15)8-18(12,16)17/h9-10H,4-8H2,1-3H3 |
| InChIKey | VSTKLBWEGZEXNU-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |