C12H19FN2O4S — CID 168675207
[1-(1-acetylpiperidin-4-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168675207) has the molecular formula C12H19FN2O4S and a molecular weight of 306.36 g/mol. Its IUPAC name is [1-(1-acetylpiperidin-4-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(1-acetylpiperidin-4-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168675207 |
| Molecular Formula | C12H19FN2O4S |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | [1-(1-acetylpiperidin-4-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | CC(=O)N1CCC(N2CC(CS(=O)(=O)F)CC2=O)CC1 |
| InChI | InChI=1S/C12H19FN2O4S/c1-9(16)14-4-2-11(3-5-14)15-7-10(6-12(15)17)8-20(13,18)19/h10-11H,2-8H2,1H3 |
| InChIKey | XIQXLRICFOTPSK-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |