C14H27FN2O3S — CID 168675277
[1-[3-(dipropylamino)propyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168675277) has the molecular formula C14H27FN2O3S and a molecular weight of 322.45 g/mol. Its IUPAC name is [1-[3-(dipropylamino)propyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-[3-(dipropylamino)propyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168675277 |
| Molecular Formula | C14H27FN2O3S |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | [1-[3-(dipropylamino)propyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | CCCN(CCC)CCCN1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C14H27FN2O3S/c1-3-6-16(7-4-2)8-5-9-17-11-13(10-14(17)18)12-21(15,19)20/h13H,3-12H2,1-2H3 |
| InChIKey | LDMCKCMDVHPQPM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |