C13H14FN3O3S2 — CID 168677741
[5-oxo-1-[2-(thiophen-2-ylmethyl)pyrazol-3-yl]pyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168677741) has the molecular formula C13H14FN3O3S2 and a molecular weight of 343.41 g/mol. Its IUPAC name is [5-oxo-1-[2-(thiophen-2-ylmethyl)pyrazol-3-yl]pyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [5-oxo-1-[2-(thiophen-2-ylmethyl)pyrazol-3-yl]pyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168677741 |
| Molecular Formula | C13H14FN3O3S2 |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | [5-oxo-1-[2-(thiophen-2-ylmethyl)pyrazol-3-yl]pyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | O=C1CC(CS(=O)(=O)F)CN1c1ccnn1Cc1cccs1 |
| InChI | InChI=1S/C13H14FN3O3S2/c14-22(19,20)9-10-6-13(18)16(7-10)12-3-4-15-17(12)8-11-2-1-5-21-11/h1-5,10H,6-9H2 |
| InChIKey | CNJMLOTVQLLLFR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |