C10H14FN3O4S — CID 168677743
[1-[1-(2-hydroxyethyl)pyrazol-4-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168677743) has the molecular formula C10H14FN3O4S and a molecular weight of 291.30 g/mol. Its IUPAC name is [1-[1-(2-hydroxyethyl)pyrazol-4-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-[1-(2-hydroxyethyl)pyrazol-4-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168677743 |
| Molecular Formula | C10H14FN3O4S |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | [1-[1-(2-hydroxyethyl)pyrazol-4-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | O=C1CC(CS(=O)(=O)F)CN1c1cnn(CCO)c1 |
| InChI | InChI=1S/C10H14FN3O4S/c11-19(17,18)7-8-3-10(16)14(5-8)9-4-12-13(6-9)1-2-15/h4,6,8,15H,1-3,5,7H2 |
| InChIKey | GXSLTGVOKXNBNQ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |