C22H29ClN4 — CID 168679011
(2S)-2-[(4-chlorophenyl)methyl]-4-methyl-1-(1-pyridin-2-ylpiperidin-4-yl)piperazine (PubChem CID 168679011) has the molecular formula C22H29ClN4 and a molecular weight of 384.95 g/mol. Its IUPAC name is (2S)-2-[(4-chlorophenyl)methyl]-4-methyl-1-(1-pyridin-2-ylpiperidin-4-yl)piperazine.
| Compound Name | (2S)-2-[(4-chlorophenyl)methyl]-4-methyl-1-(1-pyridin-2-ylpiperidin-4-yl)piperazine |
|---|---|
| PubChem CID | 168679011 |
| Molecular Formula | C22H29ClN4 |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | (2S)-2-[(4-chlorophenyl)methyl]-4-methyl-1-(1-pyridin-2-ylpiperidin-4-yl)piperazine |
| SMILES | CN1CCN(C2CCN(c3ccccn3)CC2)[C@@H](Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C22H29ClN4/c1-25-14-15-27(21(17-25)16-18-5-7-19(23)8-6-18)20-9-12-26(13-10-20)22-4-2-3-11-24-22/h2-8,11,20-21H,9-10,12-17H2,1H3/t21-/m0/s1 |
| InChIKey | FPZOUEGZKVMNEN-NRFANRHFSA-N |
| XLogP | 3.56 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |