C27H30ClN3O — CID 168679085
(5S)-5-[(4-chlorophenyl)methyl]-2-phenyl-4-(1-pyridin-3-ylpiperidin-4-yl)morpholine (PubChem CID 168679085) has the molecular formula C27H30ClN3O and a molecular weight of 448.01 g/mol. Its IUPAC name is (5S)-5-[(4-chlorophenyl)methyl]-2-phenyl-4-(1-pyridin-3-ylpiperidin-4-yl)morpholine.
| Compound Name | (5S)-5-[(4-chlorophenyl)methyl]-2-phenyl-4-(1-pyridin-3-ylpiperidin-4-yl)morpholine |
|---|---|
| PubChem CID | 168679085 |
| Molecular Formula | C27H30ClN3O |
| Molecular Weight | 448.01 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | (5S)-5-[(4-chlorophenyl)methyl]-2-phenyl-4-(1-pyridin-3-ylpiperidin-4-yl)morpholine |
| SMILES | Clc1ccc(C[C@H]2COC(c3ccccc3)CN2C2CCN(c3cccnc3)CC2)cc1 |
| InChI | InChI=1S/C27H30ClN3O/c28-23-10-8-21(9-11-23)17-26-20-32-27(22-5-2-1-3-6-22)19-31(26)24-12-15-30(16-13-24)25-7-4-14-29-18-25/h1-11,14,18,24,26-27H,12-13,15-17,19-20H2/t26-,27?/m0/s1 |
| InChIKey | LTOTYAHTRWSDRC-QBHOUYDASA-N |
| XLogP | 5.39 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.01 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |