C15H26N2O — CID 168683442
1-[2-(2,6-dimethylpiperidin-1-yl)ethyl]-4-ethenylpyrrolidin-2-one (PubChem CID 168683442) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylpiperidin-1-yl)ethyl]-4-ethenylpyrrolidin-2-one.
| Compound Name | 1-[2-(2,6-dimethylpiperidin-1-yl)ethyl]-4-ethenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168683442 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 1-[2-(2,6-dimethylpiperidin-1-yl)ethyl]-4-ethenylpyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(CCN2C(C)CCCC2C)C1 |
| InChI | InChI=1S/C15H26N2O/c1-4-14-10-15(18)16(11-14)8-9-17-12(2)6-5-7-13(17)3/h4,12-14H,1,5-11H2,2-3H3 |
| InChIKey | BGGGNVARTMQXIC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|