C18H30N2O3 — CID 168683485
tert-butyl 4-(4-ethenyl-2-oxopyrrolidin-1-yl)-3,3-dimethylpiperidine-1-carboxylate (PubChem CID 168683485) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is tert-butyl 4-(4-ethenyl-2-oxopyrrolidin-1-yl)-3,3-dimethylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-ethenyl-2-oxopyrrolidin-1-yl)-3,3-dimethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 168683485 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | tert-butyl 4-(4-ethenyl-2-oxopyrrolidin-1-yl)-3,3-dimethylpiperidine-1-carboxylate |
| SMILES | C=CC1CC(=O)N(C2CCN(C(=O)OC(C)(C)C)CC2(C)C)C1 |
| InChI | InChI=1S/C18H30N2O3/c1-7-13-10-15(21)20(11-13)14-8-9-19(12-18(14,5)6)16(22)23-17(2,3)4/h7,13-14H,1,8-12H2,2-6H3 |
| InChIKey | HYVMTIYEOPFYAX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|