C21H34N2O5 — CID 97115120
ditert-butyl (4S)-3-oxo-4-prop-2-enyl-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate (PubChem CID 97115120) has the molecular formula C21H34N2O5 and a molecular weight of 394.51 g/mol. Its IUPAC name is ditert-butyl (4S)-3-oxo-4-prop-2-enyl-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate.
| Compound Name | ditert-butyl (4S)-3-oxo-4-prop-2-enyl-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate |
|---|---|
| PubChem CID | 97115120 |
| Molecular Formula | C21H34N2O5 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | ditert-butyl (4S)-3-oxo-4-prop-2-enyl-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate |
| SMILES | C=CC[C@@H]1C(=O)N(C(=O)OC(C)(C)C)CC12CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C21H34N2O5/c1-8-9-15-16(24)23(18(26)28-20(5,6)7)14-21(15)10-12-22(13-11-21)17(25)27-19(2,3)4/h8,15H,1,9-14H2,2-7H3/t15-/m1/s1 |
| InChIKey | DZRZZMWVJRMUBZ-OAHLLOKOSA-N |
| XLogP | 3.97 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|