C24H38N2O5 — CID 71304228
ditert-butyl 3-oxo-4,4-bis(prop-2-enyl)-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate (PubChem CID 71304228) has the molecular formula C24H38N2O5 and a molecular weight of 434.58 g/mol. Its IUPAC name is ditert-butyl 3-oxo-4,4-bis(prop-2-enyl)-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate.
| Compound Name | ditert-butyl 3-oxo-4,4-bis(prop-2-enyl)-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate |
|---|---|
| PubChem CID | 71304228 |
| Molecular Formula | C24H38N2O5 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | ditert-butyl 3-oxo-4,4-bis(prop-2-enyl)-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate |
| SMILES | C=CCC1(CC=C)C(=O)N(C(=O)OC(C)(C)C)CC12CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C24H38N2O5/c1-9-11-24(12-10-2)18(27)26(20(29)31-22(6,7)8)17-23(24)13-15-25(16-14-23)19(28)30-21(3,4)5/h9-10H,1-2,11-17H2,3-8H3 |
| InChIKey | JXVRLBYHNMWBRB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|