C16H26N2O3 — CID 71304711
tert-butyl 3-oxo-4-prop-2-enyl-2,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 71304711) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is tert-butyl 3-oxo-4-prop-2-enyl-2,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 3-oxo-4-prop-2-enyl-2,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 71304711 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | tert-butyl 3-oxo-4-prop-2-enyl-2,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | C=CCC1C(=O)NCC12CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C16H26N2O3/c1-5-6-12-13(19)17-11-16(12)7-9-18(10-8-16)14(20)21-15(2,3)4/h5,12H,1,6-11H2,2-4H3,(H,17,19) |
| InChIKey | IMLXYPHSHFACFN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|