C16H26N2O3 — CID 168683499
tert-butyl (2R)-2-[(4-ethenyl-2-oxopyrrolidin-1-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 168683499) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(4-ethenyl-2-oxopyrrolidin-1-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(4-ethenyl-2-oxopyrrolidin-1-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 168683499 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | tert-butyl (2R)-2-[(4-ethenyl-2-oxopyrrolidin-1-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | C=CC1CC(=O)N(C[C@H]2CCCN2C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H26N2O3/c1-5-12-9-14(19)17(10-12)11-13-7-6-8-18(13)15(20)21-16(2,3)4/h5,12-13H,1,6-11H2,2-4H3/t12?,13-/m1/s1 |
| InChIKey | JIVIOZLTLRALTR-ZGTCLIOFSA-N |
| XLogP | 2.42 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|