C16H19NO3 — CID 168683979
propan-2-yl 4-(4-ethenyl-2-oxopyrrolidin-1-yl)benzoate (PubChem CID 168683979) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is propan-2-yl 4-(4-ethenyl-2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | propan-2-yl 4-(4-ethenyl-2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 168683979 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | propan-2-yl 4-(4-ethenyl-2-oxopyrrolidin-1-yl)benzoate |
| SMILES | C=CC1CC(=O)N(c2ccc(C(=O)OC(C)C)cc2)C1 |
| InChI | InChI=1S/C16H19NO3/c1-4-12-9-15(18)17(10-12)14-7-5-13(6-8-14)16(19)20-11(2)3/h4-8,11-12H,1,9-10H2,2-3H3 |
| InChIKey | RXTMBYPAIQCHJL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|