C22H22ClNO5 — CID 2982010
(4-chlorophenyl)methyl 5-oxo-1-(4-propan-2-yloxycarbonylphenyl)pyrrolidine-3-carboxylate (PubChem CID 2982010) has the molecular formula C22H22ClNO5 and a molecular weight of 415.87 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 5-oxo-1-(4-propan-2-yloxycarbonylphenyl)pyrrolidine-3-carboxylate.
| Compound Name | (4-chlorophenyl)methyl 5-oxo-1-(4-propan-2-yloxycarbonylphenyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 2982010 |
| Molecular Formula | C22H22ClNO5 |
| Molecular Weight | 415.87 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | (4-chlorophenyl)methyl 5-oxo-1-(4-propan-2-yloxycarbonylphenyl)pyrrolidine-3-carboxylate |
| SMILES | CC(C)OC(=O)c1ccc(N2CC(C(=O)OCc3ccc(Cl)cc3)CC2=O)cc1 |
| InChI | InChI=1S/C22H22ClNO5/c1-14(2)29-22(27)16-5-9-19(10-6-16)24-12-17(11-20(24)25)21(26)28-13-15-3-7-18(23)8-4-15/h3-10,14,17H,11-13H2,1-2H3 |
| InChIKey | FDWGFECOUMRFRL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.87 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |