C11H14N2OS — CID 168685036
4-ethenyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrrolidin-2-one (PubChem CID 168685036) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 4-ethenyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrrolidin-2-one.
| Compound Name | 4-ethenyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168685036 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 4-ethenyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(Cc2nc(C)cs2)C1 |
| InChI | InChI=1S/C11H14N2OS/c1-3-9-4-11(14)13(5-9)6-10-12-8(2)7-15-10/h3,7,9H,1,4-6H2,2H3 |
| InChIKey | LKJBWSQISKLYFE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|