C19H17NO — CID 168685806
4-ethenyl-1-(9H-fluoren-2-yl)pyrrolidin-2-one (PubChem CID 168685806) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-ethenyl-1-(9H-fluoren-2-yl)pyrrolidin-2-one.
| Compound Name | 4-ethenyl-1-(9H-fluoren-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168685806 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 4-ethenyl-1-(9H-fluoren-2-yl)pyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2ccc3c(c2)Cc2ccccc2-3)C1 |
| InChI | InChI=1S/C19H17NO/c1-2-13-9-19(21)20(12-13)16-7-8-18-15(11-16)10-14-5-3-4-6-17(14)18/h2-8,11,13H,1,9-10,12H2 |
| InChIKey | CCJXFTUZJVRQPB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|