C8H7ClN4O — CID 168688855
5-(4-chloro-2-oxopyrrolidin-1-yl)-1H-pyrazole-4-carbonitrile (PubChem CID 168688855) has the molecular formula C8H7ClN4O and a molecular weight of 210.62 g/mol. Its IUPAC name is 5-(4-chloro-2-oxopyrrolidin-1-yl)-1H-pyrazole-4-carbonitrile.
| Compound Name | 5-(4-chloro-2-oxopyrrolidin-1-yl)-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 168688855 |
| Molecular Formula | C8H7ClN4O |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 5-(4-chloro-2-oxopyrrolidin-1-yl)-1H-pyrazole-4-carbonitrile |
| SMILES | N#Cc1cn[nH]c1N1CC(Cl)CC1=O |
| InChI | InChI=1S/C8H7ClN4O/c9-6-1-7(14)13(4-6)8-5(2-10)3-11-12-8/h3,6H,1,4H2,(H,11,12) |
| InChIKey | NGODZCNYWFBBJE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|