C10H8N4O2 — CID 79503209
5-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)-1H-pyrazole-4-carbonitrile (PubChem CID 79503209) has the molecular formula C10H8N4O2 and a molecular weight of 216.20 g/mol. Its IUPAC name is 5-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)-1H-pyrazole-4-carbonitrile.
| Compound Name | 5-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 79503209 |
| Molecular Formula | C10H8N4O2 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 5-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)-1H-pyrazole-4-carbonitrile |
| SMILES | CC1=C(C)C(=O)N(c2[nH]ncc2C#N)C1=O |
| InChI | InChI=1S/C10H8N4O2/c1-5-6(2)10(16)14(9(5)15)8-7(3-11)4-12-13-8/h4H,1-2H3,(H,12,13) |
| InChIKey | XQNBLHKJYWEVGA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|