C8H6ClF3N2OS — CID 168689929
4-chloro-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrrolidin-2-one (PubChem CID 168689929) has the molecular formula C8H6ClF3N2OS and a molecular weight of 270.66 g/mol. Its IUPAC name is 4-chloro-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrrolidin-2-one.
| Compound Name | 4-chloro-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168689929 |
| Molecular Formula | C8H6ClF3N2OS |
| Molecular Weight | 270.66 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | 4-chloro-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrrolidin-2-one |
| SMILES | O=C1CC(Cl)CN1c1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C8H6ClF3N2OS/c9-4-1-6(15)14(2-4)7-13-5(3-16-7)8(10,11)12/h3-4H,1-2H2 |
| InChIKey | VSWZXWMWUWMVIV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.66 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|