C8H11ClN2OS — CID 2081014
N-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-ethylacetamide (PubChem CID 2081014) has the molecular formula C8H11ClN2OS and a molecular weight of 218.71 g/mol. Its IUPAC name is N-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-ethylacetamide.
| Compound Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 2081014 |
| Molecular Formula | C8H11ClN2OS |
| Molecular Weight | 218.71 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-ethylacetamide |
| SMILES | CCN(C(C)=O)c1nc(CCl)cs1 |
| InChI | InChI=1S/C8H11ClN2OS/c1-3-11(6(2)12)8-10-7(4-9)5-13-8/h5H,3-4H2,1-2H3 |
| InChIKey | QAHGTFJTWCLCBX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.71 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|