C7H8ClFN2OS — CID 166427927
2-chloro-2-fluoro-N-methyl-N-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 166427927) has the molecular formula C7H8ClFN2OS and a molecular weight of 222.67 g/mol. Its IUPAC name is 2-chloro-2-fluoro-N-methyl-N-(4-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-chloro-2-fluoro-N-methyl-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 166427927 |
| Molecular Formula | C7H8ClFN2OS |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 2-chloro-2-fluoro-N-methyl-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1csc(N(C)C(=O)C(F)Cl)n1 |
| InChI | InChI=1S/C7H8ClFN2OS/c1-4-3-13-7(10-4)11(2)6(12)5(8)9/h3,5H,1-2H3 |
| InChIKey | VDUPEFXOTYLUPJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|