C12H17NO5 — CID 168691308
1-(1-carboxycyclohexyl)-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 168691308) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is 1-(1-carboxycyclohexyl)-5-oxopyrrolidine-3-carboxylic acid.
| Compound Name | 1-(1-carboxycyclohexyl)-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 168691308 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 1-(1-carboxycyclohexyl)-5-oxopyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CC(=O)N(C2(C(=O)O)CCCCC2)C1 |
| InChI | InChI=1S/C12H17NO5/c14-9-6-8(10(15)16)7-13(9)12(11(17)18)4-2-1-3-5-12/h8H,1-7H2,(H,15,16)(H,17,18) |
| InChIKey | YMJWQQCHUZIAAT-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |