C8H11NO3S — CID 168709235
1-(2-oxo-4-sulfanylpyrrolidin-1-yl)cyclopropane-1-carboxylic acid (PubChem CID 168709235) has the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. Its IUPAC name is 1-(2-oxo-4-sulfanylpyrrolidin-1-yl)cyclopropane-1-carboxylic acid.
| Compound Name | 1-(2-oxo-4-sulfanylpyrrolidin-1-yl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 168709235 |
| Molecular Formula | C8H11NO3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 1-(2-oxo-4-sulfanylpyrrolidin-1-yl)cyclopropane-1-carboxylic acid |
| SMILES | O=C1CC(S)CN1C1(C(=O)O)CC1 |
| InChI | InChI=1S/C8H11NO3S/c10-6-3-5(13)4-9(6)8(1-2-8)7(11)12/h5,13H,1-4H2,(H,11,12) |
| InChIKey | ZGFVHCBTUXUHQD-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|