C10H8ClIN2O3 — CID 168691565
1-(3-chloro-5-iodo-4-pyridinyl)-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 168691565) has the molecular formula C10H8ClIN2O3 and a molecular weight of 366.54 g/mol. Its IUPAC name is 1-(3-chloro-5-iodo-4-pyridinyl)-5-oxopyrrolidine-3-carboxylic acid.
| Compound Name | 1-(3-chloro-5-iodo-4-pyridinyl)-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 168691565 |
| Molecular Formula | C10H8ClIN2O3 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 365.93 |
| IUPAC Name | 1-(3-chloro-5-iodo-4-pyridinyl)-5-oxopyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CC(=O)N(c2c(Cl)cncc2I)C1 |
| InChI | InChI=1S/C10H8ClIN2O3/c11-6-2-13-3-7(12)9(6)14-4-5(10(16)17)1-8(14)15/h2-3,5H,1,4H2,(H,16,17) |
| InChIKey | RCMFZUPSDPECTC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|